About 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene
1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene (PubChem CID 70372863) has the molecular formula C30H30O
and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene |
| PubChem CID | 70372863 |
| Molecular Formula | C30H30O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(-c2c(C)cccc2Oc2cccc(C)c2-c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C30H30O/c1-19-13-20(2)16-25(15-19)29-23(5)9-7-11-27(29)31-28-12-8-10-24(6)30(28)26-17-21(3)14-22(4)18-26/h7-18H,1-6H3 |
| InChIKey | NALCEVXJEBCWEV-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene?
The IUPAC name of 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene (CID 70372863) is 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene.
What is the SMILES notation for 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene?
The canonical SMILES for 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene is Cc1cc(C)cc(-c2c(C)cccc2Oc2cccc(C)c2-c2cc(C)cc(C)c2)c1.
What is the InChIKey of 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene?
The InChIKey is NALCEVXJEBCWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30O/c1-19-13-20(2)16-25(15-19)29-23(5)9-7-11-27(29)31-28-12-8-10-24(6)30(28)26-17-21(3)14-22(4)18-26/h7-18H,1-6H3.
What are the key properties of 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene?
1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene has a molecular weight of 406.57 g/mol, XLogP of 8.66, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(3,5-dimethylphenyl)-3-methylphenoxy]-6-methylphenyl]-3,5-dimethylbenzene is sourced from PubChem (CID 70372863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).