C12H16ClNO — CID 70373280
N-ethyl-4,7-dimethyl-1-benzofuran-2-amine;hydrochloride (PubChem CID 70373280) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is N-ethyl-4,7-dimethyl-1-benzofuran-2-amine;hydrochloride.
| Compound Name | N-ethyl-4,7-dimethyl-1-benzofuran-2-amine;hydrochloride |
|---|---|
| PubChem CID | 70373280 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-ethyl-4,7-dimethyl-1-benzofuran-2-amine;hydrochloride |
| SMILES | CCNc1cc2c(C)ccc(C)c2o1.Cl |
| InChI | InChI=1S/C12H15NO.ClH/c1-4-13-11-7-10-8(2)5-6-9(3)12(10)14-11;/h5-7,13H,4H2,1-3H3;1H |
| InChIKey | RKYSEDHQMSKBDB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |