C25H32Cl2N4O3 — CID 70373387
(5R)-9-chloro-7-N,8-N-diethyl-5-[4-(ethylcarbamoyl)phenyl]-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-dicarboxamide;hydrochloride (PubChem CID 70373387) has the molecular formula C25H32Cl2N4O3 and a molecular weight of 507.46 g/mol. Its IUPAC name is (5R)-9-chloro-7-N,8-N-diethyl-5-[4-(ethylcarbamoyl)phenyl]-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-dicarboxamide;hydrochloride.
| Compound Name | (5R)-9-chloro-7-N,8-N-diethyl-5-[4-(ethylcarbamoyl)phenyl]-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 70373387 |
| Molecular Formula | C25H32Cl2N4O3 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (5R)-9-chloro-7-N,8-N-diethyl-5-[4-(ethylcarbamoyl)phenyl]-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-dicarboxamide;hydrochloride |
| SMILES | CCNC(=O)c1ccc([C@H]2CNCCc3c2cc(C(=O)NCC)c(C(=O)NCC)c3Cl)cc1.Cl |
| InChI | InChI=1S/C25H31ClN4O3.ClH/c1-4-28-23(31)16-9-7-15(8-10-16)20-14-27-12-11-17-18(20)13-19(24(32)29-5-2)21(22(17)26)25(33)30-6-3;/h7-10,13,20,27H,4-6,11-12,14H2,1-3H3,(H,28,31)(H,29,32)(H,30,33);1H/t20-;/m1./s1 |
| InChIKey | NBOXEOVYLWLJOL-VEIFNGETSA-N |
| XLogP | 3.29 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |