About furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone
furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone (PubChem CID 70373391) has the molecular formula C12H7NO3S
and a molecular weight of 245.26 g/mol. Its IUPAC name is furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone.
Molecular Properties
| Compound Name | furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone |
| PubChem CID | 70373391 |
| Molecular Formula | C12H7NO3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone |
| SMILES | O=C(c1ccco1)c1ccc(-c2nccs2)o1 |
| InChI | InChI=1S/C12H7NO3S/c14-11(8-2-1-6-15-8)9-3-4-10(16-9)12-13-5-7-17-12/h1-7H |
| InChIKey | ACLVZJUWAZRTIS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone?
The IUPAC name of furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone (CID 70373391) is furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone.
What is the SMILES notation for furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone?
The canonical SMILES for furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone is O=C(c1ccco1)c1ccc(-c2nccs2)o1.
What is the InChIKey of furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone?
The InChIKey is ACLVZJUWAZRTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO3S/c14-11(8-2-1-6-15-8)9-3-4-10(16-9)12-13-5-7-17-12/h1-7H.
What are the key properties of furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone?
furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone has a molecular weight of 245.26 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-yl-[5-(1,3-thiazol-2-yl)furan-2-yl]methanone is sourced from PubChem (CID 70373391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).