About (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium
(3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium (PubChem CID 70373625) has the molecular formula C5H9N3NaO6S
and a molecular weight of 262.20 g/mol.
Molecular Properties
| Compound Name | (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium |
| PubChem CID | 70373625 |
| Molecular Formula | C5H9N3NaO6S |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | — |
| SMILES | NC(=O)OC[C@@H]1[C@H](N)C(=O)N1S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C5H9N3O6S.Na/c6-3-2(1-14-5(7)10)8(4(3)9)15(11,12)13;/h2-3H,1,6H2,(H2,7,10)(H,11,12,13);/t2-,3+;/m1./s1 |
| InChIKey | WXBPHUYWRAHVHL-MUWMCQJSSA-N |
| XLogP | -2.96 |
| TPSA | 153.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium?
The IUPAC name of (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium (CID 70373625) is not available.
What is the SMILES notation for (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium?
The canonical SMILES for (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium is NC(=O)OC[C@@H]1[C@H](N)C(=O)N1S(=O)(=O)O.[Na].
What is the InChIKey of (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium?
The InChIKey is WXBPHUYWRAHVHL-MUWMCQJSSA-N. The full InChI is InChI=1S/C5H9N3O6S.Na/c6-3-2(1-14-5(7)10)8(4(3)9)15(11,12)13;/h2-3H,1,6H2,(H2,7,10)(H,11,12,13);/t2-,3+;/m1./s1.
What are the key properties of (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium?
(3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium has a molecular weight of 262.20 g/mol, XLogP of -2.96, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-amino-4-carbamoyloxymethyl-2-oxo-1-azetidine-sulfonic acid sodium is sourced from PubChem (CID 70373625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).