C15H12O — CID 70373650
8-oxatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,10,12,14-heptaene (PubChem CID 70373650) has the molecular formula C15H12O and a molecular weight of 208.26 g/mol. Its IUPAC name is 8-oxatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,10,12,14-heptaene.
| Compound Name | 8-oxatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,10,12,14-heptaene |
|---|---|
| PubChem CID | 70373650 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 8-oxatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,10,12,14-heptaene |
| SMILES | C1=Cc2ccccc2-c2ccccc2OC1 |
| InChI | InChI=1S/C15H12O/c1-2-8-13-12(6-1)7-5-11-16-15-10-4-3-9-14(13)15/h1-10H,11H2 |
| InChIKey | IVJBDVPVMAODNR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |