About 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate
4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate (PubChem CID 70373782) has the molecular formula C18H24N4O3
and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate.
Molecular Properties
| Compound Name | 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate |
| PubChem CID | 70373782 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate |
| SMILES | CC(N)=CC(=O)OCCCCNc1ccc(C2=NNC(=O)CC2)cc1 |
| InChI | InChI=1S/C18H24N4O3/c1-13(19)12-18(24)25-11-3-2-10-20-15-6-4-14(5-7-15)16-8-9-17(23)22-21-16/h4-7,12,20H,2-3,8-11,19H2,1H3,(H,22,23) |
| InChIKey | AMIWHBJOMAXIQI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate?
The IUPAC name of 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate (CID 70373782) is 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate.
What is the SMILES notation for 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate?
The canonical SMILES for 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate is CC(N)=CC(=O)OCCCCNc1ccc(C2=NNC(=O)CC2)cc1.
What is the InChIKey of 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate?
The InChIKey is AMIWHBJOMAXIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3/c1-13(19)12-18(24)25-11-3-2-10-20-15-6-4-14(5-7-15)16-8-9-17(23)22-21-16/h4-7,12,20H,2-3,8-11,19H2,1H3,(H,22,23).
What are the key properties of 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate?
4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate has a molecular weight of 344.42 g/mol, XLogP of 1.90, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]butyl 3-aminobut-2-enoate is sourced from PubChem (CID 70373782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).