C15H18ClNO5 — CID 70373844
chloro 3-[[2,2-dimethoxyethyl(methyl)amino]methyl]-1-benzofuran-2-carboxylate (PubChem CID 70373844) has the molecular formula C15H18ClNO5 and a molecular weight of 327.76 g/mol. Its IUPAC name is chloro 3-[[2,2-dimethoxyethyl(methyl)amino]methyl]-1-benzofuran-2-carboxylate.
| Compound Name | chloro 3-[[2,2-dimethoxyethyl(methyl)amino]methyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 70373844 |
| Molecular Formula | C15H18ClNO5 |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | chloro 3-[[2,2-dimethoxyethyl(methyl)amino]methyl]-1-benzofuran-2-carboxylate |
| SMILES | COC(CN(C)Cc1c(C(=O)OCl)oc2ccccc12)OC |
| InChI | InChI=1S/C15H18ClNO5/c1-17(9-13(19-2)20-3)8-11-10-6-4-5-7-12(10)21-14(11)15(18)22-16/h4-7,13H,8-9H2,1-3H3 |
| InChIKey | FMLFNZBNSBMOPW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|