C13H12O10 — CID 70374546
2,5-dihydroxy-6-methoxycarbonyl-3,3a,6,6a-tetrahydropentalene-1,3,4-tricarboxylic acid (PubChem CID 70374546) has the molecular formula C13H12O10 and a molecular weight of 328.23 g/mol. Its IUPAC name is 2,5-dihydroxy-6-methoxycarbonyl-3,3a,6,6a-tetrahydropentalene-1,3,4-tricarboxylic acid.
| Compound Name | 2,5-dihydroxy-6-methoxycarbonyl-3,3a,6,6a-tetrahydropentalene-1,3,4-tricarboxylic acid |
|---|---|
| PubChem CID | 70374546 |
| Molecular Formula | C13H12O10 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2,5-dihydroxy-6-methoxycarbonyl-3,3a,6,6a-tetrahydropentalene-1,3,4-tricarboxylic acid |
| SMILES | COC(=O)C1C(O)=C(C(=O)O)C2C(C(=O)O)C(O)=C(C(=O)O)C12 |
| InChI | InChI=1S/C13H12O10/c1-23-13(22)7-3-2(5(9(7)15)11(18)19)4(10(16)17)8(14)6(3)12(20)21/h2-4,7,14-15H,1H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | GZULDFGRLVHHDI-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |