About 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol
1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol (PubChem CID 70375087) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol.
Molecular Properties
| Compound Name | 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol |
| PubChem CID | 70375087 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol |
| SMILES | C=CCC(O)(CC(O)C(N)O)N1CCCC1 |
| InChI | InChI=1S/C11H22N2O3/c1-2-5-11(16,8-9(14)10(12)15)13-6-3-4-7-13/h2,9-10,14-16H,1,3-8,12H2 |
| InChIKey | SWAZFXJNGRJACN-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol?
The IUPAC name of 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol (CID 70375087) is 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol.
What is the SMILES notation for 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol?
The canonical SMILES for 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol is C=CCC(O)(CC(O)C(N)O)N1CCCC1.
What is the InChIKey of 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol?
The InChIKey is SWAZFXJNGRJACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-2-5-11(16,8-9(14)10(12)15)13-6-3-4-7-13/h2,9-10,14-16H,1,3-8,12H2.
What are the key properties of 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol?
1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol has a molecular weight of 230.31 g/mol, XLogP of -0.62, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-pyrrolidin-1-ylhept-6-ene-1,2,4-triol is sourced from PubChem (CID 70375087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).