C20H21N — CID 70375741
6-(4-phenylbut-1-ynyl)-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 70375741) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is 6-(4-phenylbut-1-ynyl)-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 6-(4-phenylbut-1-ynyl)-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 70375741 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 6-(4-phenylbut-1-ynyl)-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | C(#Cc1cccc2c1CCNCC2)CCc1ccccc1 |
| InChI | InChI=1S/C20H21N/c1-2-7-17(8-3-1)9-4-5-10-18-11-6-12-19-13-15-21-16-14-20(18)19/h1-3,6-8,11-12,21H,4,9,13-16H2 |
| InChIKey | BGHLTPWSYZVAAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|