C19H26ClN — CID 70375772
6-(3-cyclohexylprop-1-ynyl)-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride (PubChem CID 70375772) has the molecular formula C19H26ClN and a molecular weight of 303.88 g/mol. Its IUPAC name is 6-(3-cyclohexylprop-1-ynyl)-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride.
| Compound Name | 6-(3-cyclohexylprop-1-ynyl)-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride |
|---|---|
| PubChem CID | 70375772 |
| Molecular Formula | C19H26ClN |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 6-(3-cyclohexylprop-1-ynyl)-2,3,4,5-tetrahydro-1H-3-benzazepine;hydrochloride |
| SMILES | C(#Cc1cccc2c1CCNCC2)CC1CCCCC1.Cl |
| InChI | InChI=1S/C19H25N.ClH/c1-2-6-16(7-3-1)8-4-9-17-10-5-11-18-12-14-20-15-13-19(17)18;/h5,10-11,16,20H,1-3,6-8,12-15H2;1H |
| InChIKey | CGWSLISPMHNFMD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|