C13H9N3O4S — CID 70375976
(1-amino-4-carbamoyl-[1]benzothiolo[3,2-c]pyridin-7-yl) hydrogen carbonate (PubChem CID 70375976) has the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. Its IUPAC name is (1-amino-4-carbamoyl-[1]benzothiolo[3,2-c]pyridin-7-yl) hydrogen carbonate.
| Compound Name | (1-amino-4-carbamoyl-[1]benzothiolo[3,2-c]pyridin-7-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70375976 |
| Molecular Formula | C13H9N3O4S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (1-amino-4-carbamoyl-[1]benzothiolo[3,2-c]pyridin-7-yl) hydrogen carbonate |
| SMILES | NC(=O)c1cnc(N)c2c1sc1cc(OC(=O)O)ccc12 |
| InChI | InChI=1S/C13H9N3O4S/c14-11-9-6-2-1-5(20-13(18)19)3-8(6)21-10(9)7(4-16-11)12(15)17/h1-4H,(H2,14,16)(H2,15,17)(H,18,19) |
| InChIKey | SOORLVDERHGBJX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|