C35H65FO5Si2 — CID 70376282
methyl 7-[(1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-(1-methylcyclohexyl)prop-1-enyl]-5-hydroxycyclopentyl]-7-fluorohept-5-enoate (PubChem CID 70376282) has the molecular formula C35H65FO5Si2 and a molecular weight of 641.07 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-(1-methylcyclohexyl)prop-1-enyl]-5-hydroxycyclopentyl]-7-fluorohept-5-enoate.
| Compound Name | methyl 7-[(1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-(1-methylcyclohexyl)prop-1-enyl]-5-hydroxycyclopentyl]-7-fluorohept-5-enoate |
|---|---|
| PubChem CID | 70376282 |
| Molecular Formula | C35H65FO5Si2 |
| Molecular Weight | 641.07 g/mol |
| Exact Mass | 640.44 |
| IUPAC Name | methyl 7-[(1S,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-3-(1-methylcyclohexyl)prop-1-enyl]-5-hydroxycyclopentyl]-7-fluorohept-5-enoate |
| SMILES | COC(=O)CCCC=CC(F)[C@H]1[C@@H](/C=C/C(O[Si](C)(C)C(C)(C)C)C2(C)CCCCC2)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C35H65FO5Si2/c1-33(2,3)42(9,10)40-29-25-28(37)32(27(36)19-15-13-16-20-31(38)39-8)26(29)21-22-30(35(7)23-17-14-18-24-35)41-43(11,12)34(4,5)6/h15,19,21-22,26-30,32,37H,13-14,16-18,20,23-25H2,1-12H3/b19-15?,22-21+/t26-,27?,28-,29+,30?,32+/m0/s1 |
| InChIKey | VWQQFONAOMELPX-WQBZWBKSSA-N |
| XLogP | 9.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.07 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|