C21H27F3N3O2+ — CID 70376525
ethyl 1-pyrrolidin-1-yl-1-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-carboxylate (PubChem CID 70376525) has the molecular formula C21H27F3N3O2+ and a molecular weight of 410.46 g/mol. Its IUPAC name is ethyl 1-pyrrolidin-1-yl-1-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-carboxylate.
| Compound Name | ethyl 1-pyrrolidin-1-yl-1-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 70376525 |
| Molecular Formula | C21H27F3N3O2+ |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | ethyl 1-pyrrolidin-1-yl-1-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-carboxylate |
| SMILES | CCOC(=O)C1=N[N+](c2cccc(C(F)(F)F)c2)(N2CCCC2)C2CCCCC12 |
| InChI | InChI=1S/C21H27F3N3O2/c1-2-29-20(28)19-17-10-3-4-11-18(17)27(25-19,26-12-5-6-13-26)16-9-7-8-15(14-16)21(22,23)24/h7-9,14,17-18H,2-6,10-13H2,1H3/q+1 |
| InChIKey | BBSLFHUTRWWWMJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|