C20H27FN3O2+ — CID 70376533
ethyl 1-(4-fluorophenyl)-1-pyrrolidin-1-yl-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-carboxylate (PubChem CID 70376533) has the molecular formula C20H27FN3O2+ and a molecular weight of 360.45 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-1-pyrrolidin-1-yl-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-1-pyrrolidin-1-yl-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 70376533 |
| Molecular Formula | C20H27FN3O2+ |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-1-pyrrolidin-1-yl-3a,4,5,6,7,7a-hexahydroindazol-1-ium-3-carboxylate |
| SMILES | CCOC(=O)C1=N[N+](c2ccc(F)cc2)(N2CCCC2)C2CCCCC12 |
| InChI | InChI=1S/C20H27FN3O2/c1-2-26-20(25)19-17-7-3-4-8-18(17)24(22-19,23-13-5-6-14-23)16-11-9-15(21)10-12-16/h9-12,17-18H,2-8,13-14H2,1H3/q+1 |
| InChIKey | CLEJBORQSLYJKG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|