About 2-phenylsulfanylethyl 2,2-dimethylpropanoate
2-phenylsulfanylethyl 2,2-dimethylpropanoate (PubChem CID 70376764) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-phenylsulfanylethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2-phenylsulfanylethyl 2,2-dimethylpropanoate |
| PubChem CID | 70376764 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-phenylsulfanylethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCSc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-13(2,3)12(14)15-9-10-16-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | NGQJJFCWLKJZAB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylethyl 2,2-dimethylpropanoate?
The IUPAC name of 2-phenylsulfanylethyl 2,2-dimethylpropanoate (CID 70376764) is 2-phenylsulfanylethyl 2,2-dimethylpropanoate.
What is the SMILES notation for 2-phenylsulfanylethyl 2,2-dimethylpropanoate?
The canonical SMILES for 2-phenylsulfanylethyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCCSc1ccccc1.
What is the InChIKey of 2-phenylsulfanylethyl 2,2-dimethylpropanoate?
The InChIKey is NGQJJFCWLKJZAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S/c1-13(2,3)12(14)15-9-10-16-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3.
What are the key properties of 2-phenylsulfanylethyl 2,2-dimethylpropanoate?
2-phenylsulfanylethyl 2,2-dimethylpropanoate has a molecular weight of 238.35 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 70376764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).