About [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate
[1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate (PubChem CID 70377403) has the molecular formula C25H26F3NO2
and a molecular weight of 429.48 g/mol. Its IUPAC name is [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate.
Molecular Properties
| Compound Name | [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate |
| PubChem CID | 70377403 |
| Molecular Formula | C25H26F3NO2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate |
| SMILES | CC(=O)OC(N)(CCCc1cc(C(F)(F)F)cc2ccccc12)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C25H26F3NO2/c1-16-10-11-21(13-17(16)2)24(29,31-18(3)30)12-6-8-20-15-22(25(26,27)28)14-19-7-4-5-9-23(19)20/h4-5,7,9-11,13-15H,6,8,12,29H2,1-3H3 |
| InChIKey | STILOWBNWNGSRC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate?
The IUPAC name of [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate (CID 70377403) is [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate.
What is the SMILES notation for [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate?
The canonical SMILES for [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate is CC(=O)OC(N)(CCCc1cc(C(F)(F)F)cc2ccccc12)c1ccc(C)c(C)c1.
What is the InChIKey of [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate?
The InChIKey is STILOWBNWNGSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26F3NO2/c1-16-10-11-21(13-17(16)2)24(29,31-18(3)30)12-6-8-20-15-22(25(26,27)28)14-19-7-4-5-9-23(19)20/h4-5,7,9-11,13-15H,6,8,12,29H2,1-3H3.
What are the key properties of [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate?
[1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate has a molecular weight of 429.48 g/mol, XLogP of 6.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-1-(3,4-dimethylphenyl)-4-[3-(trifluoromethyl)naphthalen-1-yl]butyl] acetate is sourced from PubChem (CID 70377403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).