C22H42O4 — CID 70377557
(2R,3S,4R)-3-(1,4-dihydroxy-4-methyloctyl)-4-hydroxy-2-octylcyclopentan-1-one (PubChem CID 70377557) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is (2R,3S,4R)-3-(1,4-dihydroxy-4-methyloctyl)-4-hydroxy-2-octylcyclopentan-1-one.
| Compound Name | (2R,3S,4R)-3-(1,4-dihydroxy-4-methyloctyl)-4-hydroxy-2-octylcyclopentan-1-one |
|---|---|
| PubChem CID | 70377557 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | (2R,3S,4R)-3-(1,4-dihydroxy-4-methyloctyl)-4-hydroxy-2-octylcyclopentan-1-one |
| SMILES | CCCCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1C(O)CCC(C)(O)CCCC |
| InChI | InChI=1S/C22H42O4/c1-4-6-8-9-10-11-12-17-19(24)16-20(25)21(17)18(23)13-15-22(3,26)14-7-5-2/h17-18,20-21,23,25-26H,4-16H2,1-3H3/t17-,18?,20+,21-,22?/m0/s1 |
| InChIKey | BTDLXPFJRMOSKS-YZEJOSAVSA-N |
| XLogP | 4.39 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|