About 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine
2-methoxy-5-phenyl-1,3,2-oxazaphospholidine (PubChem CID 70377704) has the molecular formula C9H12NO2P
and a molecular weight of 197.17 g/mol. Its IUPAC name is 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine.
Molecular Properties
| Compound Name | 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine |
| PubChem CID | 70377704 |
| Molecular Formula | C9H12NO2P |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine |
| SMILES | COP1NCC(c2ccccc2)O1 |
| InChI | InChI=1S/C9H12NO2P/c1-11-13-10-7-9(12-13)8-5-3-2-4-6-8/h2-6,9-10H,7H2,1H3 |
| InChIKey | FSNBPOLMNIJERC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine?
The IUPAC name of 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine (CID 70377704) is 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine.
What is the SMILES notation for 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine?
The canonical SMILES for 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine is COP1NCC(c2ccccc2)O1.
What is the InChIKey of 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine?
The InChIKey is FSNBPOLMNIJERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NO2P/c1-11-13-10-7-9(12-13)8-5-3-2-4-6-8/h2-6,9-10H,7H2,1H3.
What are the key properties of 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine?
2-methoxy-5-phenyl-1,3,2-oxazaphospholidine has a molecular weight of 197.17 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-phenyl-1,3,2-oxazaphospholidine is sourced from PubChem (CID 70377704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).