C30H39NO5 — CID 70377962
7-[(1R,2R,3S,5S)-3-hydroxy-5-[[4-(4-hydroxyphenyl)phenyl]methoxy]-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid (PubChem CID 70377962) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is 7-[(1R,2R,3S,5S)-3-hydroxy-5-[[4-(4-hydroxyphenyl)phenyl]methoxy]-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid.
| Compound Name | 7-[(1R,2R,3S,5S)-3-hydroxy-5-[[4-(4-hydroxyphenyl)phenyl]methoxy]-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70377962 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 7-[(1R,2R,3S,5S)-3-hydroxy-5-[[4-(4-hydroxyphenyl)phenyl]methoxy]-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CCC=CCC[C@@H]1[C@@H](N2CCCCC2)[C@@H](O)C[C@@H]1OCc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C30H39NO5/c32-25-16-14-24(15-17-25)23-12-10-22(11-13-23)21-36-28-20-27(33)30(31-18-6-3-7-19-31)26(28)8-4-1-2-5-9-29(34)35/h1-2,10-17,26-28,30,32-33H,3-9,18-21H2,(H,34,35)/t26-,27-,28-,30+/m0/s1 |
| InChIKey | UZALPBRCKUBYOQ-VNDOHOEKSA-N |
| XLogP | 5.38 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|