About naphthalen-1-amine;naphthalen-2-amine
naphthalen-1-amine;naphthalen-2-amine (PubChem CID 70377972) has the molecular formula C20H18N2
and a molecular weight of 286.38 g/mol. Its IUPAC name is naphthalen-1-amine;naphthalen-2-amine.
Molecular Properties
| Compound Name | naphthalen-1-amine;naphthalen-2-amine |
| PubChem CID | 70377972 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | naphthalen-1-amine;naphthalen-2-amine |
| SMILES | Nc1ccc2ccccc2c1.Nc1cccc2ccccc12 |
| InChI | InChI=1S/2C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10;11-10-6-5-8-3-1-2-4-9(8)7-10/h2*1-7H,11H2 |
| InChIKey | KLYWOECPXNAJPC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-amine;naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-amine;naphthalen-2-amine?
The IUPAC name of naphthalen-1-amine;naphthalen-2-amine (CID 70377972) is naphthalen-1-amine;naphthalen-2-amine.
What is the SMILES notation for naphthalen-1-amine;naphthalen-2-amine?
The canonical SMILES for naphthalen-1-amine;naphthalen-2-amine is Nc1ccc2ccccc2c1.Nc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-amine;naphthalen-2-amine?
The InChIKey is KLYWOECPXNAJPC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10;11-10-6-5-8-3-1-2-4-9(8)7-10/h2*1-7H,11H2.
What are the key properties of naphthalen-1-amine;naphthalen-2-amine?
naphthalen-1-amine;naphthalen-2-amine has a molecular weight of 286.38 g/mol, XLogP of 4.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-amine;naphthalen-2-amine is sourced from PubChem (CID 70377972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).