About 6-phenylthieno[2,3-d]thiadiazole
6-phenylthieno[2,3-d]thiadiazole (PubChem CID 70378438) has the molecular formula C10H6N2S2
and a molecular weight of 218.31 g/mol. Its IUPAC name is 6-phenylthieno[2,3-d]thiadiazole.
Molecular Properties
| Compound Name | 6-phenylthieno[2,3-d]thiadiazole |
| PubChem CID | 70378438 |
| Molecular Formula | C10H6N2S2 |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 6-phenylthieno[2,3-d]thiadiazole |
| SMILES | c1ccc(-c2csc3nnsc23)cc1 |
| InChI | InChI=1S/C10H6N2S2/c1-2-4-7(5-3-1)8-6-13-10-9(8)14-12-11-10/h1-6H |
| InChIKey | YBEVGCAYBKXHHA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenylthieno[2,3-d]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylthieno[2,3-d]thiadiazole?
The IUPAC name of 6-phenylthieno[2,3-d]thiadiazole (CID 70378438) is 6-phenylthieno[2,3-d]thiadiazole.
What is the SMILES notation for 6-phenylthieno[2,3-d]thiadiazole?
The canonical SMILES for 6-phenylthieno[2,3-d]thiadiazole is c1ccc(-c2csc3nnsc23)cc1.
What is the InChIKey of 6-phenylthieno[2,3-d]thiadiazole?
The InChIKey is YBEVGCAYBKXHHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2S2/c1-2-4-7(5-3-1)8-6-13-10-9(8)14-12-11-10/h1-6H.
What are the key properties of 6-phenylthieno[2,3-d]thiadiazole?
6-phenylthieno[2,3-d]thiadiazole has a molecular weight of 218.31 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylthieno[2,3-d]thiadiazole is sourced from PubChem (CID 70378438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).