C15H17N3O6 — CID 70378668
2-methyl-3-[(2S,4R)-2-methyl-3,4-dihydro-2H-chromen-4-yl]imidazole-4-carboxylic acid;nitric acid (PubChem CID 70378668) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-methyl-3-[(2S,4R)-2-methyl-3,4-dihydro-2H-chromen-4-yl]imidazole-4-carboxylic acid;nitric acid.
| Compound Name | 2-methyl-3-[(2S,4R)-2-methyl-3,4-dihydro-2H-chromen-4-yl]imidazole-4-carboxylic acid;nitric acid |
|---|---|
| PubChem CID | 70378668 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-methyl-3-[(2S,4R)-2-methyl-3,4-dihydro-2H-chromen-4-yl]imidazole-4-carboxylic acid;nitric acid |
| SMILES | Cc1ncc(C(=O)O)n1[C@@H]1C[C@H](C)Oc2ccccc21.O=[N+]([O-])O |
| InChI | InChI=1S/C15H16N2O3.HNO3/c1-9-7-12(11-5-3-4-6-14(11)20-9)17-10(2)16-8-13(17)15(18)19;2-1(3)4/h3-6,8-9,12H,7H2,1-2H3,(H,18,19);(H,2,3,4)/t9-,12+;/m0./s1 |
| InChIKey | NDHSNTBXTKTFDT-PKKHVXKMSA-N |
| XLogP | 2.30 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|