About [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide
[3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide (PubChem CID 70378763) has the molecular formula C21H21N3O4S
and a molecular weight of 411.48 g/mol. Its IUPAC name is [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide |
| PubChem CID | 70378763 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide |
| SMILES | Cn1cc(CCCN2C(=O)c3ccccc3C2=O)c2cc(CS(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H21N3O4S/c1-23-12-15(18-11-14(8-9-19(18)23)13-29(22,27)28)5-4-10-24-20(25)16-6-2-3-7-17(16)21(24)26/h2-3,6-9,11-12H,4-5,10,13H2,1H3,(H2,22,27,28) |
| InChIKey | OJQURVQPRFCSSJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide?
The IUPAC name of [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide (CID 70378763) is [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide.
What is the SMILES notation for [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide?
The canonical SMILES for [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide is Cn1cc(CCCN2C(=O)c3ccccc3C2=O)c2cc(CS(N)(=O)=O)ccc21.
What is the InChIKey of [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide?
The InChIKey is OJQURVQPRFCSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O4S/c1-23-12-15(18-11-14(8-9-19(18)23)13-29(22,27)28)5-4-10-24-20(25)16-6-2-3-7-17(16)21(24)26/h2-3,6-9,11-12H,4-5,10,13H2,1H3,(H2,22,27,28).
What are the key properties of [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide?
[3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide has a molecular weight of 411.48 g/mol, XLogP of 2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(1,3-dioxoisoindol-2-yl)propyl]-1-methylindol-5-yl]methanesulfonamide is sourced from PubChem (CID 70378763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).