C29H26N2O6 — CID 70378954
3-[[5-[2-[4-(2-cyanoethenoxy)-2,3,7,8-tetrahydrofuro[2,3-g][1]benzofuran-5-yl]propan-2-yl]-2,3,7,8-tetrahydrofuro[2,3-g][1]benzofuran-4-yl]oxy]prop-2-enenitrile (PubChem CID 70378954) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is 3-[[5-[2-[4-(2-cyanoethenoxy)-2,3,7,8-tetrahydrofuro[2,3-g][1]benzofuran-5-yl]propan-2-yl]-2,3,7,8-tetrahydrofuro[2,3-g][1]benzofuran-4-yl]oxy]prop-2-enenitrile.
| Compound Name | 3-[[5-[2-[4-(2-cyanoethenoxy)-2,3,7,8-tetrahydrofuro[2,3-g][1]benzofuran-5-yl]propan-2-yl]-2,3,7,8-tetrahydrofuro[2,3-g][1]benzofuran-4-yl]oxy]prop-2-enenitrile |
|---|---|
| PubChem CID | 70378954 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 3-[[5-[2-[4-(2-cyanoethenoxy)-2,3,7,8-tetrahydrofuro[2,3-g][1]benzofuran-5-yl]propan-2-yl]-2,3,7,8-tetrahydrofuro[2,3-g][1]benzofuran-4-yl]oxy]prop-2-enenitrile |
| SMILES | CC(C)(c1c(OC=CC#N)c2c(c3c1OCC3)OCC2)c1c(OC=CC#N)c2c(c3c1OCC3)OCC2 |
| InChI | InChI=1S/C29H26N2O6/c1-29(2,21-25(32-11-3-9-30)17-5-13-34-23(17)19-7-15-36-27(19)21)22-26(33-12-4-10-31)18-6-14-35-24(18)20-8-16-37-28(20)22/h3-4,11-12H,5-8,13-16H2,1-2H3 |
| InChIKey | DLWUEGXRVCWJRI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 102.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|