C17H22N2 — CID 70379153
1-ethyl-1,2,3,4,6,7,7a,7b-octahydroindolo[2,3-a]quinolizine (PubChem CID 70379153) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-ethyl-1,2,3,4,6,7,7a,7b-octahydroindolo[2,3-a]quinolizine.
| Compound Name | 1-ethyl-1,2,3,4,6,7,7a,7b-octahydroindolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 70379153 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-ethyl-1,2,3,4,6,7,7a,7b-octahydroindolo[2,3-a]quinolizine |
| SMILES | CCC1CCCN2CCC3C(=C12)N=C1C=CC=CC13 |
| InChI | InChI=1S/C17H22N2/c1-2-12-6-5-10-19-11-9-14-13-7-3-4-8-15(13)18-16(14)17(12)19/h3-4,7-8,12-14H,2,5-6,9-11H2,1H3 |
| InChIKey | ILMWPNYRDQRUMO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |