About N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide
N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide (PubChem CID 7037973) has the molecular formula C19H26FN2O+
and a molecular weight of 317.43 g/mol. Its IUPAC name is N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide.
Molecular Properties
| Compound Name | N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide |
| PubChem CID | 7037973 |
| Molecular Formula | C19H26FN2O+ |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide |
| SMILES | CCCCN(C(=O)c1ccc(F)cc1)C1=C[C@@H]2CC[C@H](C1)[NH+]2C |
| InChI | InChI=1S/C19H25FN2O/c1-3-4-11-22(19(23)14-5-7-15(20)8-6-14)18-12-16-9-10-17(13-18)21(16)2/h5-8,12,16-17H,3-4,9-11,13H2,1-2H3/p+1/t16-,17+/m0/s1 |
| InChIKey | FPNVTFWFUHBNPU-DLBZAZTESA-O |
| XLogP | 2.40 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide?
The IUPAC name of N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide (CID 7037973) is N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide.
What is the SMILES notation for N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide?
The canonical SMILES for N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide is CCCCN(C(=O)c1ccc(F)cc1)C1=C[C@@H]2CC[C@H](C1)[NH+]2C.
What is the InChIKey of N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide?
The InChIKey is FPNVTFWFUHBNPU-DLBZAZTESA-O. The full InChI is InChI=1S/C19H25FN2O/c1-3-4-11-22(19(23)14-5-7-15(20)8-6-14)18-12-16-9-10-17(13-18)21(16)2/h5-8,12,16-17H,3-4,9-11,13H2,1-2H3/p+1/t16-,17+/m0/s1.
What are the key properties of N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide?
N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide has a molecular weight of 317.43 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-fluoro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]oct-2-en-3-yl]benzamide is sourced from PubChem (CID 7037973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).