C24H20N2O — CID 70380554
3,3-dimethyl-5,6-diphenyl-1,7-dihydropyrrolo[3,2-f]indol-2-one (PubChem CID 70380554) has the molecular formula C24H20N2O and a molecular weight of 352.44 g/mol. Its IUPAC name is 3,3-dimethyl-5,6-diphenyl-1,7-dihydropyrrolo[3,2-f]indol-2-one.
| Compound Name | 3,3-dimethyl-5,6-diphenyl-1,7-dihydropyrrolo[3,2-f]indol-2-one |
|---|---|
| PubChem CID | 70380554 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3,3-dimethyl-5,6-diphenyl-1,7-dihydropyrrolo[3,2-f]indol-2-one |
| SMILES | CC1(C)C(=O)Nc2cc3[nH]c(-c4ccccc4)c(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C24H20N2O/c1-24(2)18-13-17-19(14-20(18)26-23(24)27)25-22(16-11-7-4-8-12-16)21(17)15-9-5-3-6-10-15/h3-14,25H,1-2H3,(H,26,27) |
| InChIKey | YTNTZPLIMUXVPW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |