C23H27NO4 — CID 70380773
1-(7,8-dimethoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl)-2-(2-methoxyphenyl)ethanone (PubChem CID 70380773) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 1-(7,8-dimethoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl)-2-(2-methoxyphenyl)ethanone.
| Compound Name | 1-(7,8-dimethoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl)-2-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 70380773 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-(7,8-dimethoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl)-2-(2-methoxyphenyl)ethanone |
| SMILES | COc1ccccc1CC(=O)N1CC2CCc3cc(OC)c(OC)cc3C2C1 |
| InChI | InChI=1S/C23H27NO4/c1-26-20-7-5-4-6-16(20)11-23(25)24-13-17-9-8-15-10-21(27-2)22(28-3)12-18(15)19(17)14-24/h4-7,10,12,17,19H,8-9,11,13-14H2,1-3H3 |
| InChIKey | TWPDQUFFFDWAIP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |