C27H26ClN3O6S — CID 70380956
[(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] 2-chloro-5-nitrobenzoate (PubChem CID 70380956) has the molecular formula C27H26ClN3O6S and a molecular weight of 556.04 g/mol. Its IUPAC name is [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] 2-chloro-5-nitrobenzoate.
| Compound Name | [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 70380956 |
| Molecular Formula | C27H26ClN3O6S |
| Molecular Weight | 556.04 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] 2-chloro-5-nitrobenzoate |
| SMILES | COc1ccc([C@@H]2Sc3ccccc3N(CCN(C)C)C(=O)[C@@H]2OC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C27H26ClN3O6S/c1-29(2)14-15-30-22-6-4-5-7-23(22)38-25(17-8-11-19(36-3)12-9-17)24(26(30)32)37-27(33)20-16-18(31(34)35)10-13-21(20)28/h4-13,16,24-25H,14-15H2,1-3H3/t24-,25+/m1/s1 |
| InChIKey | ZOXFNSUQWCKIRR-RPBOFIJWSA-N |
| XLogP | 5.22 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.04 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|