About N-methylpyrimidin-4-amine;propanedioic acid
N-methylpyrimidin-4-amine;propanedioic acid (PubChem CID 70381240) has the molecular formula C8H11N3O4
and a molecular weight of 213.19 g/mol. Its IUPAC name is N-methylpyrimidin-4-amine;propanedioic acid.
Molecular Properties
| Compound Name | N-methylpyrimidin-4-amine;propanedioic acid |
| PubChem CID | 70381240 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | N-methylpyrimidin-4-amine;propanedioic acid |
| SMILES | CNc1ccncn1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C5H7N3.C3H4O4/c1-6-5-2-3-7-4-8-5;4-2(5)1-3(6)7/h2-4H,1H3,(H,6,7,8);1H2,(H,4,5)(H,6,7) |
| InChIKey | TVJNGKUSJMFWGV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-methylpyrimidin-4-amine;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpyrimidin-4-amine;propanedioic acid?
The IUPAC name of N-methylpyrimidin-4-amine;propanedioic acid (CID 70381240) is N-methylpyrimidin-4-amine;propanedioic acid.
What is the SMILES notation for N-methylpyrimidin-4-amine;propanedioic acid?
The canonical SMILES for N-methylpyrimidin-4-amine;propanedioic acid is CNc1ccncn1.O=C(O)CC(=O)O.
What is the InChIKey of N-methylpyrimidin-4-amine;propanedioic acid?
The InChIKey is TVJNGKUSJMFWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3.C3H4O4/c1-6-5-2-3-7-4-8-5;4-2(5)1-3(6)7/h2-4H,1H3,(H,6,7,8);1H2,(H,4,5)(H,6,7).
What are the key properties of N-methylpyrimidin-4-amine;propanedioic acid?
N-methylpyrimidin-4-amine;propanedioic acid has a molecular weight of 213.19 g/mol, XLogP of 0.06, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpyrimidin-4-amine;propanedioic acid is sourced from PubChem (CID 70381240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).