C18H17ClN2O — CID 70381272
(7S,11bS)-7-(4-chlorophenyl)-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one (PubChem CID 70381272) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is (7S,11bS)-7-(4-chlorophenyl)-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one.
| Compound Name | (7S,11bS)-7-(4-chlorophenyl)-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one |
|---|---|
| PubChem CID | 70381272 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (7S,11bS)-7-(4-chlorophenyl)-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one |
| SMILES | O=C1NCCN2C[C@@H](c3ccc(Cl)cc3)c3ccccc3[C@@H]12 |
| InChI | InChI=1S/C18H17ClN2O/c19-13-7-5-12(6-8-13)16-11-21-10-9-20-18(22)17(21)15-4-2-1-3-14(15)16/h1-8,16-17H,9-11H2,(H,20,22)/t16-,17-/m0/s1 |
| InChIKey | LVJXJUCIVWNVJN-IRXDYDNUSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |