C18H14N2OS — CID 7038159
1-[(2R)-5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl]naphthalen-2-ol (PubChem CID 7038159) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[(2R)-5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl]naphthalen-2-ol.
| Compound Name | 1-[(2R)-5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 7038159 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1-[(2R)-5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1[C@@H]1NN=C(c2ccccc2)S1 |
| InChI | InChI=1S/C18H14N2OS/c21-15-11-10-12-6-4-5-9-14(12)16(15)18-20-19-17(22-18)13-7-2-1-3-8-13/h1-11,18,20-21H/t18-/m1/s1 |
| InChIKey | QIHMPEZAXBQNBF-GOSISDBHSA-N |
| XLogP | 4.24 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|