C26H26BrN3O6S — CID 70381623
[(2R,3R)-2-(4-methoxyphenyl)-5-[2-(methylamino)ethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] 4-nitrobenzoate;hydrobromide (PubChem CID 70381623) has the molecular formula C26H26BrN3O6S and a molecular weight of 588.48 g/mol. Its IUPAC name is [(2R,3R)-2-(4-methoxyphenyl)-5-[2-(methylamino)ethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] 4-nitrobenzoate;hydrobromide.
| Compound Name | [(2R,3R)-2-(4-methoxyphenyl)-5-[2-(methylamino)ethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] 4-nitrobenzoate;hydrobromide |
|---|---|
| PubChem CID | 70381623 |
| Molecular Formula | C26H26BrN3O6S |
| Molecular Weight | 588.48 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | [(2R,3R)-2-(4-methoxyphenyl)-5-[2-(methylamino)ethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] 4-nitrobenzoate;hydrobromide |
| SMILES | Br.CNCCN1C(=O)[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@@H](c2ccc(OC)cc2)Sc2ccccc21 |
| InChI | InChI=1S/C26H25N3O6S.BrH/c1-27-15-16-28-21-5-3-4-6-22(21)36-24(17-9-13-20(34-2)14-10-17)23(25(28)30)35-26(31)18-7-11-19(12-8-18)29(32)33;/h3-14,23-24,27H,15-16H2,1-2H3;1H/t23-,24+;/m0./s1 |
| InChIKey | QZJCULONRXFBBH-KZDWWKKTSA-N |
| XLogP | 4.81 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|