C13H12ClNO — CID 70381828
1-chloro-2,4,5,6-tetrahydro-1H-benzo[f]quinolin-3-one (PubChem CID 70381828) has the molecular formula C13H12ClNO and a molecular weight of 233.70 g/mol. Its IUPAC name is 1-chloro-2,4,5,6-tetrahydro-1H-benzo[f]quinolin-3-one.
| Compound Name | 1-chloro-2,4,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 70381828 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-chloro-2,4,5,6-tetrahydro-1H-benzo[f]quinolin-3-one |
| SMILES | O=C1CC(Cl)C2=C(CCc3ccccc32)N1 |
| InChI | InChI=1S/C13H12ClNO/c14-10-7-12(16)15-11-6-5-8-3-1-2-4-9(8)13(10)11/h1-4,10H,5-7H2,(H,15,16) |
| InChIKey | ZGKSPAWGISGYRK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|