About N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine
N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine (PubChem CID 70382080) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine.
Molecular Properties
| Compound Name | N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine |
| PubChem CID | 70382080 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine |
| SMILES | CNCCOCC1=CCC=C(C)N1 |
| InChI | InChI=1S/C10H18N2O/c1-9-4-3-5-10(12-9)8-13-7-6-11-2/h4-5,11-12H,3,6-8H2,1-2H3 |
| InChIKey | VJSBYIABPJCGGS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine?
The IUPAC name of N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine (CID 70382080) is N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine.
What is the SMILES notation for N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine?
The canonical SMILES for N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine is CNCCOCC1=CCC=C(C)N1.
What is the InChIKey of N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine?
The InChIKey is VJSBYIABPJCGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-9-4-3-5-10(12-9)8-13-7-6-11-2/h4-5,11-12H,3,6-8H2,1-2H3.
What are the key properties of N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine?
N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine has a molecular weight of 182.27 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[(6-methyl-1,4-dihydropyridin-2-yl)methoxy]ethanamine is sourced from PubChem (CID 70382080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).