C12H28ClN3O3 — CID 70382111
2,4,6-tris(dimethylamino)cyclohexane-1,3,5-triol;hydrochloride (PubChem CID 70382111) has the molecular formula C12H28ClN3O3 and a molecular weight of 297.83 g/mol. Its IUPAC name is 2,4,6-tris(dimethylamino)cyclohexane-1,3,5-triol;hydrochloride.
| Compound Name | 2,4,6-tris(dimethylamino)cyclohexane-1,3,5-triol;hydrochloride |
|---|---|
| PubChem CID | 70382111 |
| Molecular Formula | C12H28ClN3O3 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2,4,6-tris(dimethylamino)cyclohexane-1,3,5-triol;hydrochloride |
| SMILES | CN(C)C1C(O)C(N(C)C)C(O)C(N(C)C)C1O.Cl |
| InChI | InChI=1S/C12H27N3O3.ClH/c1-13(2)7-10(16)8(14(3)4)12(18)9(11(7)17)15(5)6;/h7-12,16-18H,1-6H3;1H |
| InChIKey | HUBZSODOMJVLME-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |