About 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine
4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine (PubChem CID 70382331) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine.
Molecular Properties
| Compound Name | 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine |
| PubChem CID | 70382331 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine |
| SMILES | CCCCCC1OC(C)C=CC(C)O1 |
| InChI | InChI=1S/C12H22O2/c1-4-5-6-7-12-13-10(2)8-9-11(3)14-12/h8-12H,4-7H2,1-3H3 |
| InChIKey | RCKOBYOBHFCMOQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine?
The IUPAC name of 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine (CID 70382331) is 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine.
What is the SMILES notation for 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine?
The canonical SMILES for 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine is CCCCCC1OC(C)C=CC(C)O1.
What is the InChIKey of 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine?
The InChIKey is RCKOBYOBHFCMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-5-6-7-12-13-10(2)8-9-11(3)14-12/h8-12H,4-7H2,1-3H3.
What are the key properties of 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine?
4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine has a molecular weight of 198.31 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-2-pentyl-4,7-dihydro-1,3-dioxepine is sourced from PubChem (CID 70382331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).