About cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate
cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate (PubChem CID 70382440) has the molecular formula C16H19NO5S
and a molecular weight of 337.40 g/mol. Its IUPAC name is cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate.
Molecular Properties
| Compound Name | cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate |
| PubChem CID | 70382440 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate |
| SMILES | CN1C(C(=O)OC2CCCCC2)=C(O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C16H19NO5S/c1-17-14(16(19)22-11-7-3-2-4-8-11)15(18)12-9-5-6-10-13(12)23(17,20)21/h5-6,9-11,18H,2-4,7-8H2,1H3 |
| InChIKey | GRTDBBMKDSLOAL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate?
The IUPAC name of cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate (CID 70382440) is cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate.
What is the SMILES notation for cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate?
The canonical SMILES for cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate is CN1C(C(=O)OC2CCCCC2)=C(O)c2ccccc2S1(=O)=O.
What is the InChIKey of cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate?
The InChIKey is GRTDBBMKDSLOAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO5S/c1-17-14(16(19)22-11-7-3-2-4-8-11)15(18)12-9-5-6-10-13(12)23(17,20)21/h5-6,9-11,18H,2-4,7-8H2,1H3.
What are the key properties of cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate?
cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate has a molecular weight of 337.40 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate is sourced from PubChem (CID 70382440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).