About 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride
7H-pyrrolo[3,4-d]pyrimidine;hydrochloride (PubChem CID 70382597) has the molecular formula C6H6ClN3
and a molecular weight of 155.59 g/mol. Its IUPAC name is 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride |
| PubChem CID | 70382597 |
| Molecular Formula | C6H6ClN3 |
| Molecular Weight | 155.59 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride |
| SMILES | C1=NCc2ncncc21.Cl |
| InChI | InChI=1S/C6H5N3.ClH/c1-5-2-8-4-9-6(5)3-7-1;/h1-2,4H,3H2;1H |
| InChIKey | DPPIAQXWUVKVPE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.59 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride?
The IUPAC name of 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride (CID 70382597) is 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride.
What is the SMILES notation for 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride?
The canonical SMILES for 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride is C1=NCc2ncncc21.Cl.
What is the InChIKey of 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride?
The InChIKey is DPPIAQXWUVKVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.ClH/c1-5-2-8-4-9-6(5)3-7-1;/h1-2,4H,3H2;1H.
What are the key properties of 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride?
7H-pyrrolo[3,4-d]pyrimidine;hydrochloride has a molecular weight of 155.59 g/mol, XLogP of 0.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrrolo[3,4-d]pyrimidine;hydrochloride is sourced from PubChem (CID 70382597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).