C11H17NO3 — CID 70382709
ethyl 2-[(3aS,6aR)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]acetate (PubChem CID 70382709) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 2-[(3aS,6aR)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]acetate.
| Compound Name | ethyl 2-[(3aS,6aR)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 70382709 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | ethyl 2-[(3aS,6aR)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]acetate |
| SMILES | CCOC(=O)CN1C[C@@H]2CCC[C@@H]2C1=O |
| InChI | InChI=1S/C11H17NO3/c1-2-15-10(13)7-12-6-8-4-3-5-9(8)11(12)14/h8-9H,2-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | NIAOISOHBPVZIC-IUCAKERBSA-N |
| XLogP | 0.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |