About 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide
2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide (PubChem CID 70382788) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide |
| PubChem CID | 70382788 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide |
| SMILES | Cc1nn(C(C)C)c(=O)n1CC(N)=O |
| InChI | InChI=1S/C8H14N4O2/c1-5(2)12-8(14)11(4-7(9)13)6(3)10-12/h5H,4H2,1-3H3,(H2,9,13) |
| InChIKey | ZZLDUAQRUVQYPV-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide?
The IUPAC name of 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide (CID 70382788) is 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide.
What is the SMILES notation for 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide?
The canonical SMILES for 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide is Cc1nn(C(C)C)c(=O)n1CC(N)=O.
What is the InChIKey of 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide?
The InChIKey is ZZLDUAQRUVQYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-5(2)12-8(14)11(4-7(9)13)6(3)10-12/h5H,4H2,1-3H3,(H2,9,13).
What are the key properties of 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide?
2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide has a molecular weight of 198.23 g/mol, XLogP of -0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-5-oxo-1-propan-2-yl-1,2,4-triazol-4-yl)acetamide is sourced from PubChem (CID 70382788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).