C10H10BrN5OS — CID 70383297
5-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one;hydrobromide (PubChem CID 70383297) has the molecular formula C10H10BrN5OS and a molecular weight of 328.20 g/mol. Its IUPAC name is 5-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one;hydrobromide.
| Compound Name | 5-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one;hydrobromide |
|---|---|
| PubChem CID | 70383297 |
| Molecular Formula | C10H10BrN5OS |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 5-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one;hydrobromide |
| SMILES | Br.Cc1nc2ncccn2c1C1=NNC(=O)SC1 |
| InChI | InChI=1S/C10H9N5OS.BrH/c1-6-8(7-5-17-10(16)14-13-7)15-4-2-3-11-9(15)12-6;/h2-4H,5H2,1H3,(H,14,16);1H |
| InChIKey | SAAXWGPQXQTBLC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|