C16H14N2OS — CID 70383447
1-(2-methylquinolin-4-yl)-3-(1,2-thiazol-5-yl)propan-1-one (PubChem CID 70383447) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 1-(2-methylquinolin-4-yl)-3-(1,2-thiazol-5-yl)propan-1-one.
| Compound Name | 1-(2-methylquinolin-4-yl)-3-(1,2-thiazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 70383447 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 1-(2-methylquinolin-4-yl)-3-(1,2-thiazol-5-yl)propan-1-one |
| SMILES | Cc1cc(C(=O)CCc2ccns2)c2ccccc2n1 |
| InChI | InChI=1S/C16H14N2OS/c1-11-10-14(13-4-2-3-5-15(13)18-11)16(19)7-6-12-8-9-17-20-12/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | VMTJMEHITUVBRX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |