About 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione
2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione (PubChem CID 70383493) has the molecular formula C15H11N3S
and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione.
Molecular Properties
| Compound Name | 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione |
| PubChem CID | 70383493 |
| Molecular Formula | C15H11N3S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione |
| SMILES | Cc1ccc2nc(=S)n3c4ccccc4[nH]c3c2c1 |
| InChI | InChI=1S/C15H11N3S/c1-9-6-7-11-10(8-9)14-16-12-4-2-3-5-13(12)18(14)15(19)17-11/h2-8,16H,1H3 |
| InChIKey | OKKIWNSKBUZRFR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione?
The IUPAC name of 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione (CID 70383493) is 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione.
What is the SMILES notation for 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione?
The canonical SMILES for 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione is Cc1ccc2nc(=S)n3c4ccccc4[nH]c3c2c1.
What is the InChIKey of 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione?
The InChIKey is OKKIWNSKBUZRFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3S/c1-9-6-7-11-10(8-9)14-16-12-4-2-3-5-13(12)18(14)15(19)17-11/h2-8,16H,1H3.
What are the key properties of 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione?
2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione has a molecular weight of 265.34 g/mol, XLogP of 4.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-12H-benzimidazolo[1,2-c]quinazoline-6-thione is sourced from PubChem (CID 70383493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).