C13H24O6 — CID 70383751
4-hydroxy-1,1-dimethoxy-4-(2,2,4,5-tetramethyl-1,3-dioxolan-4-yl)butan-2-one (PubChem CID 70383751) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-hydroxy-1,1-dimethoxy-4-(2,2,4,5-tetramethyl-1,3-dioxolan-4-yl)butan-2-one.
| Compound Name | 4-hydroxy-1,1-dimethoxy-4-(2,2,4,5-tetramethyl-1,3-dioxolan-4-yl)butan-2-one |
|---|---|
| PubChem CID | 70383751 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-hydroxy-1,1-dimethoxy-4-(2,2,4,5-tetramethyl-1,3-dioxolan-4-yl)butan-2-one |
| SMILES | COC(OC)C(=O)CC(O)C1(C)OC(C)(C)OC1C |
| InChI | InChI=1S/C13H24O6/c1-8-13(4,19-12(2,3)18-8)10(15)7-9(14)11(16-5)17-6/h8,10-11,15H,7H2,1-6H3 |
| InChIKey | PRZRWJCXKMFROA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|