C24H16N2O6S — CID 70383847
4-[[7-methoxy-2-(5-methyl-2-phenyl-1,3-oxazole-4-carbonyl)-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,5-dione (PubChem CID 70383847) has the molecular formula C24H16N2O6S and a molecular weight of 460.47 g/mol. Its IUPAC name is 4-[[7-methoxy-2-(5-methyl-2-phenyl-1,3-oxazole-4-carbonyl)-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[7-methoxy-2-(5-methyl-2-phenyl-1,3-oxazole-4-carbonyl)-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 70383847 |
| Molecular Formula | C24H16N2O6S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 4-[[7-methoxy-2-(5-methyl-2-phenyl-1,3-oxazole-4-carbonyl)-1-benzofuran-5-yl]methylidene]-1,3-thiazolidine-2,5-dione |
| SMILES | COc1cc(C=C2NC(=O)SC2=O)cc2cc(C(=O)c3nc(-c4ccccc4)oc3C)oc12 |
| InChI | InChI=1S/C24H16N2O6S/c1-12-19(26-22(31-12)14-6-4-3-5-7-14)20(27)17-11-15-8-13(10-18(30-2)21(15)32-17)9-16-23(28)33-24(29)25-16/h3-11H,1-2H3,(H,25,29) |
| InChIKey | UHFQILCLVQEORH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|