C28H34O8 — CID 70383872
(2R)-6-acetyl-7-[1-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 70383872) has the molecular formula C28H34O8 and a molecular weight of 498.57 g/mol. Its IUPAC name is (2R)-6-acetyl-7-[1-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]-3,4-dihydro-2H-chromene-2-carboxylic acid.
| Compound Name | (2R)-6-acetyl-7-[1-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]-3,4-dihydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 70383872 |
| Molecular Formula | C28H34O8 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | (2R)-6-acetyl-7-[1-(4-acetyl-3-hydroxy-2-propylphenoxy)pentoxy]-3,4-dihydro-2H-chromene-2-carboxylic acid |
| SMILES | CCCCC(Oc1cc2c(cc1C(C)=O)CC[C@H](C(=O)O)O2)Oc1ccc(C(C)=O)c(O)c1CCC |
| InChI | InChI=1S/C28H34O8/c1-5-7-9-26(35-22-13-11-19(16(3)29)27(31)20(22)8-6-2)36-25-15-24-18(14-21(25)17(4)30)10-12-23(34-24)28(32)33/h11,13-15,23,26,31H,5-10,12H2,1-4H3,(H,32,33)/t23-,26?/m1/s1 |
| InChIKey | ZPTNHXHGRYTMTO-GEPVFLLWSA-N |
| XLogP | 5.50 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|