C26H35N5O2 — CID 70384184
11-[6-(4-methylpiperazin-1-yl)-2-propylhexanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 70384184) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 11-[6-(4-methylpiperazin-1-yl)-2-propylhexanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 11-[6-(4-methylpiperazin-1-yl)-2-propylhexanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 70384184 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 11-[6-(4-methylpiperazin-1-yl)-2-propylhexanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | CCCC(CCCCN1CCN(C)CC1)C(=O)N1c2ccccc2C(=O)Nc2cccnc21 |
| InChI | InChI=1S/C26H35N5O2/c1-3-9-20(10-6-7-15-30-18-16-29(2)17-19-30)26(33)31-23-13-5-4-11-21(23)25(32)28-22-12-8-14-27-24(22)31/h4-5,8,11-14,20H,3,6-7,9-10,15-19H2,1-2H3,(H,28,32) |
| InChIKey | YEBGQQCZSGYRFM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|